C22H25F2N5O3S — CID 90366481
(1R,2S,3R,5S)-3-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-methoxy-6-methylpyrimidin-4-yl]amino]-5-(1,1-difluoroethyl)cyclopentane-1,2-diol (PubChem CID 90366481) has the molecular formula C22H25F2N5O3S and a molecular weight of 477.54 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-methoxy-6-methylpyrimidin-4-yl]amino]-5-(1,1-difluoroethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-methoxy-6-methylpyrimidin-4-yl]amino]-5-(1,1-difluoroethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 90366481 |
| Molecular Formula | C22H25F2N5O3S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (1R,2S,3R,5S)-3-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-methoxy-6-methylpyrimidin-4-yl]amino]-5-(1,1-difluoroethyl)cyclopentane-1,2-diol |
| SMILES | COc1nc(C)c(-c2nc3c(C4CC4)nccc3s2)c(N[C@@H]2C[C@H](C(C)(F)F)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C22H25F2N5O3S/c1-9-14(20-28-16-13(33-20)6-7-25-15(16)10-4-5-10)19(29-21(26-9)32-3)27-12-8-11(22(2,23)24)17(30)18(12)31/h6-7,10-12,17-18,30-31H,4-5,8H2,1-3H3,(H,26,27,29)/t11-,12+,17+,18-/m0/s1 |
| InChIKey | GCEDNMIHZFWVMH-MIFHMHLRSA-N |
| XLogP | 3.52 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |