C22H22F2N4O3 — CID 90366525
4-(1,3-diethylpyrazol-5-yl)-N-(2,3-difluoro-4,5-dimethylphenyl)-3-nitrobenzamide (PubChem CID 90366525) has the molecular formula C22H22F2N4O3 and a molecular weight of 428.44 g/mol. Its IUPAC name is 4-(1,3-diethylpyrazol-5-yl)-N-(2,3-difluoro-4,5-dimethylphenyl)-3-nitrobenzamide.
| Compound Name | 4-(1,3-diethylpyrazol-5-yl)-N-(2,3-difluoro-4,5-dimethylphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 90366525 |
| Molecular Formula | C22H22F2N4O3 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 4-(1,3-diethylpyrazol-5-yl)-N-(2,3-difluoro-4,5-dimethylphenyl)-3-nitrobenzamide |
| SMILES | CCc1cc(-c2ccc(C(=O)Nc3cc(C)c(C)c(F)c3F)cc2[N+](=O)[O-])n(CC)n1 |
| InChI | InChI=1S/C22H22F2N4O3/c1-5-15-11-18(27(6-2)26-15)16-8-7-14(10-19(16)28(30)31)22(29)25-17-9-12(3)13(4)20(23)21(17)24/h7-11H,5-6H2,1-4H3,(H,25,29) |
| InChIKey | AOLWONQMCRYFNX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|