C34H24N2O8 — CID 90366795
(E)-3-[3-[5-[6-[3,5-bis[(E)-2-carboxyethenyl]phenyl]-3-pyridinyl]-2-pyridinyl]-5-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid (PubChem CID 90366795) has the molecular formula C34H24N2O8 and a molecular weight of 588.57 g/mol. Its IUPAC name is (E)-3-[3-[5-[6-[3,5-bis[(E)-2-carboxyethenyl]phenyl]-3-pyridinyl]-2-pyridinyl]-5-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[5-[6-[3,5-bis[(E)-2-carboxyethenyl]phenyl]-3-pyridinyl]-2-pyridinyl]-5-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90366795 |
| Molecular Formula | C34H24N2O8 |
| Molecular Weight | 588.57 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | (E)-3-[3-[5-[6-[3,5-bis[(E)-2-carboxyethenyl]phenyl]-3-pyridinyl]-2-pyridinyl]-5-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(/C=C/C(=O)O)cc(-c2ccc(-c3ccc(-c4cc(/C=C/C(=O)O)cc(/C=C/C(=O)O)c4)nc3)cn2)c1 |
| InChI | InChI=1S/C34H24N2O8/c37-31(38)9-1-21-13-22(2-10-32(39)40)16-27(15-21)29-7-5-25(19-35-29)26-6-8-30(36-20-26)28-17-23(3-11-33(41)42)14-24(18-28)4-12-34(43)44/h1-20H,(H,37,38)(H,39,40)(H,41,42)(H,43,44)/b9-1+,10-2+,11-3+,12-4+ |
| InChIKey | PUFIIRGKYJRSFX-OCWUVSDQSA-N |
| XLogP | 5.87 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|