C21H21ClN4O2 — CID 90366857
1-(3-chloro-4-methoxyphenyl)-4-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)butan-2-one (PubChem CID 90366857) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-4-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)butan-2-one.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-4-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)butan-2-one |
|---|---|
| PubChem CID | 90366857 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-4-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)butan-2-one |
| SMILES | C=CCn1c(CCC(=O)Cc2ccc(OC)c(Cl)c2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C21H21ClN4O2/c1-3-11-26-20(24-25-21(26)16-5-4-10-23-14-16)9-7-17(27)12-15-6-8-19(28-2)18(22)13-15/h3-6,8,10,13-14H,1,7,9,11-12H2,2H3 |
| InChIKey | NFWCRYUDFWFRNF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|