C22H24N4O — CID 90366870
1-(2,4-dimethylphenyl)-4-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)butan-2-one (PubChem CID 90366870) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-4-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)butan-2-one.
| Compound Name | 1-(2,4-dimethylphenyl)-4-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)butan-2-one |
|---|---|
| PubChem CID | 90366870 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-4-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)butan-2-one |
| SMILES | C=CCn1c(CCC(=O)Cc2ccc(C)cc2C)nnc1-c1cccnc1 |
| InChI | InChI=1S/C22H24N4O/c1-4-12-26-21(24-25-22(26)19-6-5-11-23-15-19)10-9-20(27)14-18-8-7-16(2)13-17(18)3/h4-8,11,13,15H,1,9-10,12,14H2,2-3H3 |
| InChIKey | HFBCIIBWDGTIBL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|