C31H30O4 — CID 90367466
2-[4-(2,3-dihydrophenanthro[9,10-b]furan-2-yloxy)phenyl]pentan-2-yl 2-methylprop-2-enoate (PubChem CID 90367466) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[4-(2,3-dihydrophenanthro[9,10-b]furan-2-yloxy)phenyl]pentan-2-yl 2-methylprop-2-enoate.
| Compound Name | 2-[4-(2,3-dihydrophenanthro[9,10-b]furan-2-yloxy)phenyl]pentan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90367466 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-[4-(2,3-dihydrophenanthro[9,10-b]furan-2-yloxy)phenyl]pentan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(CCC)c1ccc(OC2Cc3c(c4ccccc4c4ccccc34)O2)cc1 |
| InChI | InChI=1S/C31H30O4/c1-5-18-31(4,35-30(32)20(2)3)21-14-16-22(17-15-21)33-28-19-27-25-12-7-6-10-23(25)24-11-8-9-13-26(24)29(27)34-28/h6-17,28H,2,5,18-19H2,1,3-4H3 |
| InChIKey | XFPNXDAFSKCYEX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|