C14H21N7O5S2 — CID 90367646
3-[[4-(dimethylamino)-6-[(methoxymethylamino)methylamino]oxysulfanyl-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 90367646) has the molecular formula C14H21N7O5S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-6-[(methoxymethylamino)methylamino]oxysulfanyl-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[4-(dimethylamino)-6-[(methoxymethylamino)methylamino]oxysulfanyl-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 90367646 |
| Molecular Formula | C14H21N7O5S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 3-[[4-(dimethylamino)-6-[(methoxymethylamino)methylamino]oxysulfanyl-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | COCNCNOSc1nc(Nc2cccc(S(=O)(=O)O)c2)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H21N7O5S2/c1-21(2)13-18-12(17-10-5-4-6-11(7-10)28(22,23)24)19-14(20-13)27-26-16-8-15-9-25-3/h4-7,15-16H,8-9H2,1-3H3,(H,22,23,24)(H,17,18,19,20) |
| InChIKey | GIXZOHKNVPCEEU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 150.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|