C24H44O9 — CID 90367811
2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate (PubChem CID 90367811) has the molecular formula C24H44O9 and a molecular weight of 476.61 g/mol. Its IUPAC name is 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate.
| Compound Name | 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate |
|---|---|
| PubChem CID | 90367811 |
| Molecular Formula | C24H44O9 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate |
| SMILES | CC(O)CCCCC(=O)OCC(COC(=O)CCCCC(C)O)OC(=O)CCCCC(C)O |
| InChI | InChI=1S/C24H44O9/c1-18(25)10-4-7-13-22(28)31-16-21(33-24(30)15-9-6-12-20(3)27)17-32-23(29)14-8-5-11-19(2)26/h18-21,25-27H,4-17H2,1-3H3 |
| InChIKey | YHUXSMSKQBANNR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|