2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate

C24H44O9 — CID 90367811

IUPAC2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate
SMILESCC(O)CCCCC(=O)OCC(COC(=O)CCCCC(C)O)OC(=O)CCCCC(C)O
InChIInChI=1S/C24H44O9/c1-18(25)10-4-7-13-22(28)31-16-21(33-24(30)15-9-6-12-20(3)27)17-32-23(29)14-8-5-11-19(2)26/h18-21,25-27H,4-17H2,1-3H3
InChIKeyYHUXSMSKQBANNR-UHFFFAOYSA-N
MW476.61 g/mol
LogP2.81
Rot. Bonds20

About 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate

2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate (PubChem CID 90367811) has the molecular formula C24H44O9 and a molecular weight of 476.61 g/mol. Its IUPAC name is 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate.

Molecular Properties

Compound Name2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate
PubChem CID90367811
Molecular FormulaC24H44O9
Molecular Weight476.61 g/mol
Exact Mass476.30
IUPAC Name2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate
SMILESCC(O)CCCCC(=O)OCC(COC(=O)CCCCC(C)O)OC(=O)CCCCC(C)O
InChIInChI=1S/C24H44O9/c1-18(25)10-4-7-13-22(28)31-16-21(33-24(30)15-9-6-12-20(3)27)17-32-23(29)14-8-5-11-19(2)26/h18-21,25-27H,4-17H2,1-3H3
InChIKeyYHUXSMSKQBANNR-UHFFFAOYSA-N
XLogP2.81
TPSA139.59 Ų
H-Bond Donors3
H-Bond Acceptors9
Rotatable Bonds20
Heavy Atoms33
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500476.61
LogP ≤ 52.81
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate?
The IUPAC name of 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate (CID 90367811) is 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate.
What is the SMILES notation for 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate?
The canonical SMILES for 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate is CC(O)CCCCC(=O)OCC(COC(=O)CCCCC(C)O)OC(=O)CCCCC(C)O.
What is the InChIKey of 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate?
The InChIKey is YHUXSMSKQBANNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O9/c1-18(25)10-4-7-13-22(28)31-16-21(33-24(30)15-9-6-12-20(3)27)17-32-23(29)14-8-5-11-19(2)26/h18-21,25-27H,4-17H2,1-3H3.
What are the key properties of 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate?
2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate has a molecular weight of 476.61 g/mol, XLogP of 2.81, 20 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(6-hydroxyheptanoyloxy)propyl 6-hydroxyheptanoate is sourced from PubChem (CID 90367811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).