About butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate
butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate (PubChem CID 90368252) has the molecular formula C15H26O5
and a molecular weight of 286.37 g/mol. Its IUPAC name is butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate.
Molecular Properties
| Compound Name | butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate |
| PubChem CID | 90368252 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate |
| SMILES | CCCCOC(=O)C1(OCC)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H26O5/c1-3-5-10-17-13(16)14(18-4-2)6-8-15(9-7-14)19-11-12-20-15/h3-12H2,1-2H3 |
| InChIKey | MROTVASWSGYZDQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate?
The IUPAC name of butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate (CID 90368252) is butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate.
What is the SMILES notation for butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate?
The canonical SMILES for butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate is CCCCOC(=O)C1(OCC)CCC2(CC1)OCCO2.
What is the InChIKey of butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate?
The InChIKey is MROTVASWSGYZDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O5/c1-3-5-10-17-13(16)14(18-4-2)6-8-15(9-7-14)19-11-12-20-15/h3-12H2,1-2H3.
What are the key properties of butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate?
butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate has a molecular weight of 286.37 g/mol, XLogP of 2.42, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate is sourced from PubChem (CID 90368252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).