C18H19ClN4O — CID 90368394
8-amino-1-(4-chlorophenyl)-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide (PubChem CID 90368394) has the molecular formula C18H19ClN4O and a molecular weight of 342.83 g/mol. Its IUPAC name is 8-amino-1-(4-chlorophenyl)-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide.
| Compound Name | 8-amino-1-(4-chlorophenyl)-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 90368394 |
| Molecular Formula | C18H19ClN4O |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 8-amino-1-(4-chlorophenyl)-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
| SMILES | CNC(=O)N1N=C(c2ccc(Cl)cc2)c2cc(N)ccc2CC1C |
| InChI | InChI=1S/C18H19ClN4O/c1-11-9-13-5-8-15(20)10-16(13)17(22-23(11)18(24)21-2)12-3-6-14(19)7-4-12/h3-8,10-11H,9,20H2,1-2H3,(H,21,24) |
| InChIKey | IMQIEERAGQHTEL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|