About 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone
1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone (PubChem CID 90368397) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone |
| PubChem CID | 90368397 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone |
| SMILES | CC(=O)C1=CN(C)C2C=CC=CC12 |
| InChI | InChI=1S/C11H13NO/c1-8(13)10-7-12(2)11-6-4-3-5-9(10)11/h3-7,9,11H,1-2H3 |
| InChIKey | KKFICACZEQMNHX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone?
The IUPAC name of 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone (CID 90368397) is 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone.
What is the SMILES notation for 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone?
The canonical SMILES for 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone is CC(=O)C1=CN(C)C2C=CC=CC12.
What is the InChIKey of 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone?
The InChIKey is KKFICACZEQMNHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-8(13)10-7-12(2)11-6-4-3-5-9(10)11/h3-7,9,11H,1-2H3.
What are the key properties of 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone?
1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone has a molecular weight of 175.23 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-3a,7a-dihydroindol-3-yl)ethanone is sourced from PubChem (CID 90368397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).