C48H43N — CID 90368522
10-phenyl-N-[2-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)butan-2-yl]anthracen-9-amine (PubChem CID 90368522) has the molecular formula C48H43N and a molecular weight of 633.88 g/mol. Its IUPAC name is 10-phenyl-N-[2-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)butan-2-yl]anthracen-9-amine.
| Compound Name | 10-phenyl-N-[2-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)butan-2-yl]anthracen-9-amine |
|---|---|
| PubChem CID | 90368522 |
| Molecular Formula | C48H43N |
| Molecular Weight | 633.88 g/mol |
| Exact Mass | 633.34 |
| IUPAC Name | 10-phenyl-N-[2-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)butan-2-yl]anthracen-9-amine |
| SMILES | CCC(C)(Nc1c2ccccc2c(-c2ccccc2)c2ccccc12)c1ccc2c(c1)C(C)(C)c1cc3c(cc1-2)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C48H43N/c1-7-48(6,49-45-36-22-13-11-20-34(36)44(30-17-9-8-10-18-30)35-21-12-14-23-37(35)45)31-25-26-33-39-29-42-38(28-43(39)47(4,5)41(33)27-31)32-19-15-16-24-40(32)46(42,2)3/h8-29,49H,7H2,1-6H3 |
| InChIKey | SAWFUAHAYJGTSH-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.88 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|