C25H29ClN6O3 — CID 90368571
2-[(6S)-16-(acetamidomethyl)-4-(4-chlorophenyl)-10-methyl-15-oxa-5,8,9,11-tetrazatetracyclo[7.5.2.03,12.07,11]hexadeca-1,3(12),4,13-tetraen-6-yl]-N-ethylacetamide (PubChem CID 90368571) has the molecular formula C25H29ClN6O3 and a molecular weight of 497.00 g/mol. Its IUPAC name is 2-[(6S)-16-(acetamidomethyl)-4-(4-chlorophenyl)-10-methyl-15-oxa-5,8,9,11-tetrazatetracyclo[7.5.2.03,12.07,11]hexadeca-1,3(12),4,13-tetraen-6-yl]-N-ethylacetamide.
| Compound Name | 2-[(6S)-16-(acetamidomethyl)-4-(4-chlorophenyl)-10-methyl-15-oxa-5,8,9,11-tetrazatetracyclo[7.5.2.03,12.07,11]hexadeca-1,3(12),4,13-tetraen-6-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 90368571 |
| Molecular Formula | C25H29ClN6O3 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2-[(6S)-16-(acetamidomethyl)-4-(4-chlorophenyl)-10-methyl-15-oxa-5,8,9,11-tetrazatetracyclo[7.5.2.03,12.07,11]hexadeca-1,3(12),4,13-tetraen-6-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@@H]1N=C(c2ccc(Cl)cc2)c2cc3ccc2N2C1NN(C(CNC(C)=O)O3)C2C |
| InChI | InChI=1S/C25H29ClN6O3/c1-4-27-22(34)12-20-25-30-32-15(3)31(25)21-10-9-18(35-23(32)13-28-14(2)33)11-19(21)24(29-20)16-5-7-17(26)8-6-16/h5-11,15,20,23,25,30H,4,12-13H2,1-3H3,(H,27,34)(H,28,33)/t15?,20-,23?,25?/m0/s1 |
| InChIKey | CWXWCQKHUYIRKN-WPZYZQEMSA-N |
| XLogP | 2.24 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|