About (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one
(5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one (PubChem CID 90368733) has the molecular formula C17H9F3O2
and a molecular weight of 302.25 g/mol. Its IUPAC name is (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one.
Molecular Properties
| Compound Name | (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one |
| PubChem CID | 90368733 |
| Molecular Formula | C17H9F3O2 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one |
| SMILES | O=C1O/C(=C/c2ccccc2)C=C1c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C17H9F3O2/c18-11-7-14(19)16(15(20)8-11)13-9-12(22-17(13)21)6-10-4-2-1-3-5-10/h1-9H/b12-6+ |
| InChIKey | KJIFMNUOLQEKSL-WUXMJOGZSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one?
The IUPAC name of (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one (CID 90368733) is (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one.
What is the SMILES notation for (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one?
The canonical SMILES for (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one is O=C1O/C(=C/c2ccccc2)C=C1c1c(F)cc(F)cc1F.
What is the InChIKey of (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one?
The InChIKey is KJIFMNUOLQEKSL-WUXMJOGZSA-N. The full InChI is InChI=1S/C17H9F3O2/c18-11-7-14(19)16(15(20)8-11)13-9-12(22-17(13)21)6-10-4-2-1-3-5-10/h1-9H/b12-6+.
What are the key properties of (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one?
(5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one has a molecular weight of 302.25 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-benzylidene-3-(2,4,6-trifluorophenyl)furan-2-one is sourced from PubChem (CID 90368733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).