About 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one
4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one (PubChem CID 90368768) has the molecular formula C17H14F2N2O2
and a molecular weight of 316.31 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one |
| PubChem CID | 90368768 |
| Molecular Formula | C17H14F2N2O2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one |
| SMILES | CC1(O)NNC(=O)C(c2c(F)cccc2F)=C1c1ccccc1 |
| InChI | InChI=1S/C17H14F2N2O2/c1-17(23)15(10-6-3-2-4-7-10)14(16(22)20-21-17)13-11(18)8-5-9-12(13)19/h2-9,21,23H,1H3,(H,20,22) |
| InChIKey | BSEOKXXPIALPAF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one?
The IUPAC name of 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one (CID 90368768) is 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one.
What is the SMILES notation for 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one?
The canonical SMILES for 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one is CC1(O)NNC(=O)C(c2c(F)cccc2F)=C1c1ccccc1.
What is the InChIKey of 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one?
The InChIKey is BSEOKXXPIALPAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2N2O2/c1-17(23)15(10-6-3-2-4-7-10)14(16(22)20-21-17)13-11(18)8-5-9-12(13)19/h2-9,21,23H,1H3,(H,20,22).
What are the key properties of 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one?
4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one has a molecular weight of 316.31 g/mol, XLogP of 2.22, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-difluorophenyl)-6-hydroxy-6-methyl-5-phenyl-1,2-dihydropyridazin-3-one is sourced from PubChem (CID 90368768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).