C23H27N7O4S — CID 90368890
[3-[3-[4-[ethyl(2-methoxyethyl)amino]furo[3,2-c]pyridin-2-yl]imidazo[1,2-b]pyridazin-6-yl]oxypropyl-methyl-oxo-λ6-sulfanylidene]cyanamide (PubChem CID 90368890) has the molecular formula C23H27N7O4S and a molecular weight of 497.58 g/mol. Its IUPAC name is [3-[3-[4-[ethyl(2-methoxyethyl)amino]furo[3,2-c]pyridin-2-yl]imidazo[1,2-b]pyridazin-6-yl]oxypropyl-methyl-oxo-λ6-sulfanylidene]cyanamide.
| Compound Name | [3-[3-[4-[ethyl(2-methoxyethyl)amino]furo[3,2-c]pyridin-2-yl]imidazo[1,2-b]pyridazin-6-yl]oxypropyl-methyl-oxo-λ6-sulfanylidene]cyanamide |
|---|---|
| PubChem CID | 90368890 |
| Molecular Formula | C23H27N7O4S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [3-[3-[4-[ethyl(2-methoxyethyl)amino]furo[3,2-c]pyridin-2-yl]imidazo[1,2-b]pyridazin-6-yl]oxypropyl-methyl-oxo-λ6-sulfanylidene]cyanamide |
| SMILES | CCN(CCOC)c1nccc2oc(-c3cnc4ccc(OCCC[S@@](C)(=O)=NC#N)nn34)cc12 |
| InChI | InChI=1S/C23H27N7O4S/c1-4-29(10-12-32-2)23-17-14-20(34-19(17)8-9-25-23)18-15-26-21-6-7-22(28-30(18)21)33-11-5-13-35(3,31)27-16-24/h6-9,14-15H,4-5,10-13H2,1-3H3/t35-/m1/s1 |
| InChIKey | SFQSUEFCVWWINZ-PGUFJCEWSA-N |
| XLogP | 3.36 |
| TPSA | 131.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|