C24H26N6O3S — CID 90369497
3-[4-(benzylsulfamoyl)anilino]-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide (PubChem CID 90369497) has the molecular formula C24H26N6O3S and a molecular weight of 478.58 g/mol. Its IUPAC name is 3-[4-(benzylsulfamoyl)anilino]-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide.
| Compound Name | 3-[4-(benzylsulfamoyl)anilino]-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90369497 |
| Molecular Formula | C24H26N6O3S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 3-[4-(benzylsulfamoyl)anilino]-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide |
| SMILES | N#C[C@H]1CCCC[C@@H]1n1cc(C(N)=O)c(Nc2ccc(S(=O)(=O)NCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C24H26N6O3S/c25-14-18-8-4-5-9-22(18)30-16-21(23(26)31)24(29-30)28-19-10-12-20(13-11-19)34(32,33)27-15-17-6-2-1-3-7-17/h1-3,6-7,10-13,16,18,22,27H,4-5,8-9,15H2,(H2,26,31)(H,28,29)/t18-,22+/m1/s1 |
| InChIKey | OSXWBBWTOFARDW-GCJKJVERSA-N |
| XLogP | 3.46 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |