C28H25F3O5 — CID 90369506
[5,5,5-trifluoro-2-[4-[(4-oxo-2,3-dihydrobenzo[g]chromen-2-yl)oxy]phenyl]pentan-2-yl] 2-methylprop-2-enoate (PubChem CID 90369506) has the molecular formula C28H25F3O5 and a molecular weight of 498.50 g/mol. Its IUPAC name is [5,5,5-trifluoro-2-[4-[(4-oxo-2,3-dihydrobenzo[g]chromen-2-yl)oxy]phenyl]pentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [5,5,5-trifluoro-2-[4-[(4-oxo-2,3-dihydrobenzo[g]chromen-2-yl)oxy]phenyl]pentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90369506 |
| Molecular Formula | C28H25F3O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [5,5,5-trifluoro-2-[4-[(4-oxo-2,3-dihydrobenzo[g]chromen-2-yl)oxy]phenyl]pentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(CCC(F)(F)F)c1ccc(OC2CC(=O)c3cc4ccccc4cc3O2)cc1 |
| InChI | InChI=1S/C28H25F3O5/c1-17(2)26(33)36-27(3,12-13-28(29,30)31)20-8-10-21(11-9-20)34-25-16-23(32)22-14-18-6-4-5-7-19(18)15-24(22)35-25/h4-11,14-15,25H,1,12-13,16H2,2-3H3 |
| InChIKey | CDLHHFADGWJDLJ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|