About ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate
ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate (PubChem CID 90369567) has the molecular formula C23H46O5Si
and a molecular weight of 430.70 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate.
Molecular Properties
| Compound Name | ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate |
| PubChem CID | 90369567 |
| Molecular Formula | C23H46O5Si |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate |
| SMILES | C[C@@H](CC(CCCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H46O5Si/c1-17(19(24)27-21(2,3)4)16-18(20(25)28-22(5,6)7)14-13-15-26-29(11,12)23(8,9)10/h17-18H,13-16H2,1-12H3/t17-,18?/m0/s1 |
| InChIKey | UWGLVCMKXSJMDW-ZENAZSQFSA-N |
| XLogP | 6.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate?
The IUPAC name of ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate (CID 90369567) is ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate.
What is the SMILES notation for ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate?
The canonical SMILES for ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate is C[C@@H](CC(CCCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate?
The InChIKey is UWGLVCMKXSJMDW-ZENAZSQFSA-N. The full InChI is InChI=1S/C23H46O5Si/c1-17(19(24)27-21(2,3)4)16-18(20(25)28-22(5,6)7)14-13-15-26-29(11,12)23(8,9)10/h17-18H,13-16H2,1-12H3/t17-,18?/m0/s1.
What are the key properties of ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate?
ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate has a molecular weight of 430.70 g/mol, XLogP of 6.11, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylpentanedioate is sourced from PubChem (CID 90369567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).