C23H31F3O4 — CID 90369646
[2-[4-(1-cyclohexyloxyethoxy)phenyl]-5,5,5-trifluoropentan-2-yl] 2-methylprop-2-enoate (PubChem CID 90369646) has the molecular formula C23H31F3O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is [2-[4-(1-cyclohexyloxyethoxy)phenyl]-5,5,5-trifluoropentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2-[4-(1-cyclohexyloxyethoxy)phenyl]-5,5,5-trifluoropentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90369646 |
| Molecular Formula | C23H31F3O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [2-[4-(1-cyclohexyloxyethoxy)phenyl]-5,5,5-trifluoropentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(CCC(F)(F)F)c1ccc(OC(C)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H31F3O4/c1-16(2)21(27)30-22(4,14-15-23(24,25)26)18-10-12-20(13-11-18)29-17(3)28-19-8-6-5-7-9-19/h10-13,17,19H,1,5-9,14-15H2,2-4H3 |
| InChIKey | IGIOJBSMDNLOIQ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|