About 3,6-dimethyl-1,2-dihydropyridazine
3,6-dimethyl-1,2-dihydropyridazine (PubChem CID 90369932) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 3,6-dimethyl-1,2-dihydropyridazine.
Molecular Properties
| Compound Name | 3,6-dimethyl-1,2-dihydropyridazine |
| PubChem CID | 90369932 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 3,6-dimethyl-1,2-dihydropyridazine |
| SMILES | CC1=CC=C(C)NN1 |
| InChI | InChI=1S/C6H10N2/c1-5-3-4-6(2)8-7-5/h3-4,7-8H,1-2H3 |
| InChIKey | IRMOYHVMRRTBJJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dimethyl-1,2-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-1,2-dihydropyridazine?
The IUPAC name of 3,6-dimethyl-1,2-dihydropyridazine (CID 90369932) is 3,6-dimethyl-1,2-dihydropyridazine.
What is the SMILES notation for 3,6-dimethyl-1,2-dihydropyridazine?
The canonical SMILES for 3,6-dimethyl-1,2-dihydropyridazine is CC1=CC=C(C)NN1.
What is the InChIKey of 3,6-dimethyl-1,2-dihydropyridazine?
The InChIKey is IRMOYHVMRRTBJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-5-3-4-6(2)8-7-5/h3-4,7-8H,1-2H3.
What are the key properties of 3,6-dimethyl-1,2-dihydropyridazine?
3,6-dimethyl-1,2-dihydropyridazine has a molecular weight of 110.16 g/mol, XLogP of 0.90, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-1,2-dihydropyridazine is sourced from PubChem (CID 90369932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).