C26H46N8O4 — CID 90369992
1-[(2S)-4-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butan-2-yl]-3-(4-tert-butylphenyl)urea (PubChem CID 90369992) has the molecular formula C26H46N8O4 and a molecular weight of 534.71 g/mol. Its IUPAC name is 1-[(2S)-4-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butan-2-yl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[(2S)-4-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butan-2-yl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 90369992 |
| Molecular Formula | C26H46N8O4 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | 1-[(2S)-4-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butan-2-yl]-3-(4-tert-butylphenyl)urea |
| SMILES | C[C@@H](CCN(C)C[C@H]1O[C@@H](N2CNC3C(N)NCNC32)[C@H](O)[C@@H]1O)NC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H46N8O4/c1-15(31-25(37)32-17-8-6-16(7-9-17)26(2,3)4)10-11-33(5)12-18-20(35)21(36)24(38-18)34-14-30-19-22(27)28-13-29-23(19)34/h6-9,15,18-24,28-30,35-36H,10-14,27H2,1-5H3,(H2,31,32,37)/t15-,18+,19?,20+,21+,22?,23?,24+/m0/s1 |
| InChIKey | KCCJPWNTZSCMRH-VPXHHPAQSA-N |
| XLogP | -0.74 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |