About 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid
1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 90370647) has the molecular formula C14H22O3S
and a molecular weight of 270.39 g/mol. Its IUPAC name is 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid |
| PubChem CID | 90370647 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CC1=CCC(C(C)C2CCCC2)(S(=O)(=O)O)C=C1 |
| InChI | InChI=1S/C14H22O3S/c1-11-7-9-14(10-8-11,18(15,16)17)12(2)13-5-3-4-6-13/h7-9,12-13H,3-6,10H2,1-2H3,(H,15,16,17) |
| InChIKey | PWHCJWCCIXUASB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid (CID 90370647) is 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid is CC1=CCC(C(C)C2CCCC2)(S(=O)(=O)O)C=C1.
What is the InChIKey of 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is PWHCJWCCIXUASB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3S/c1-11-7-9-14(10-8-11,18(15,16)17)12(2)13-5-3-4-6-13/h7-9,12-13H,3-6,10H2,1-2H3,(H,15,16,17).
What are the key properties of 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid?
1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 270.39 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclopentylethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 90370647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).