C17H10ClF4NO4 — CID 90371112
1-(3-chloro-2-pyridinyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione (PubChem CID 90371112) has the molecular formula C17H10ClF4NO4 and a molecular weight of 403.72 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione.
| Compound Name | 1-(3-chloro-2-pyridinyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 90371112 |
| Molecular Formula | C17H10ClF4NO4 |
| Molecular Weight | 403.72 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ncccc1Cl)c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C17H10ClF4NO4/c18-10-2-1-7-23-15(10)12(25)5-4-11(24)9-3-6-13-14(8-9)27-17(21,22)16(19,20)26-13/h1-3,6-8H,4-5H2 |
| InChIKey | ZCLGTTUQCLQIQT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|