About CID 90371270
CID 90371270 (PubChem CID 90371270) has the molecular formula C7H13BO6P2S
and a molecular weight of 298.00 g/mol.
Molecular Properties
| Compound Name | CID 90371270 |
| PubChem CID | 90371270 |
| Molecular Formula | C7H13BO6P2S |
| Molecular Weight | 298.00 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](/C=C/P(=O)(O)O)C[C@H]1OP(C)(O)=S |
| InChI | InChI=1S/C7H13BO6P2S/c1-15(9,17)14-6-4-5(13-7(6)8)2-3-16(10,11)12/h2-3,5-7H,4H2,1H3,(H,9,17)(H2,10,11,12)/b3-2+/t5-,6-,7-,15?/m1/s1 |
| InChIKey | QYXOIQOGMUACAJ-WBDPSCIASA-N |
| XLogP | 0.28 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.00 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 90371270 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90371270?
The IUPAC name of CID 90371270 (CID 90371270) is not available.
What is the SMILES notation for CID 90371270?
The canonical SMILES for CID 90371270 is [B][C@@H]1O[C@H](/C=C/P(=O)(O)O)C[C@H]1OP(C)(O)=S.
What is the InChIKey of CID 90371270?
The InChIKey is QYXOIQOGMUACAJ-WBDPSCIASA-N. The full InChI is InChI=1S/C7H13BO6P2S/c1-15(9,17)14-6-4-5(13-7(6)8)2-3-16(10,11)12/h2-3,5-7H,4H2,1H3,(H,9,17)(H2,10,11,12)/b3-2+/t5-,6-,7-,15?/m1/s1.
What are the key properties of CID 90371270?
CID 90371270 has a molecular weight of 298.00 g/mol, XLogP of 0.28, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90371270 is sourced from PubChem (CID 90371270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).