C21H30N2O4 — CID 90371476
5-(cyclohexen-1-yl)-1-(2-cyclohexyl-2-oxoethyl)-3-ethyl-5-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 90371476) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 5-(cyclohexen-1-yl)-1-(2-cyclohexyl-2-oxoethyl)-3-ethyl-5-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(cyclohexen-1-yl)-1-(2-cyclohexyl-2-oxoethyl)-3-ethyl-5-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90371476 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 5-(cyclohexen-1-yl)-1-(2-cyclohexyl-2-oxoethyl)-3-ethyl-5-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)N(CC(=O)C2CCCCC2)C(=O)C(C)(C2=CCCCC2)C1=O |
| InChI | InChI=1S/C21H30N2O4/c1-3-22-18(25)21(2,16-12-8-5-9-13-16)19(26)23(20(22)27)14-17(24)15-10-6-4-7-11-15/h12,15H,3-11,13-14H2,1-2H3 |
| InChIKey | GOAZPKPNTIRLCR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|