C17H25N3O3 — CID 90371540
5-cyclohexyl-3-[2-(2,5-dihydro-1H-pyrrol-3-yl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione (PubChem CID 90371540) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-cyclohexyl-3-[2-(2,5-dihydro-1H-pyrrol-3-yl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-cyclohexyl-3-[2-(2,5-dihydro-1H-pyrrol-3-yl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90371540 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 5-cyclohexyl-3-[2-(2,5-dihydro-1H-pyrrol-3-yl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(CC(=O)C2=CCNC2)C(=O)C1(C)C1CCCCC1 |
| InChI | InChI=1S/C17H25N3O3/c1-17(13-6-4-3-5-7-13)15(22)20(16(23)19(17)2)11-14(21)12-8-9-18-10-12/h8,13,18H,3-7,9-11H2,1-2H3 |
| InChIKey | WPTYRAGKPWZVGR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|