C10H11F4N5O2S — CID 90371590
4-azido-N-[2-(dimethylamino)ethyl]-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 90371590) has the molecular formula C10H11F4N5O2S and a molecular weight of 341.29 g/mol. Its IUPAC name is 4-azido-N-[2-(dimethylamino)ethyl]-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-azido-N-[2-(dimethylamino)ethyl]-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 90371590 |
| Molecular Formula | C10H11F4N5O2S |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 4-azido-N-[2-(dimethylamino)ethyl]-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C10H11F4N5O2S/c1-19(2)4-3-16-22(20,21)10-7(13)5(11)9(17-18-15)6(12)8(10)14/h16H,3-4H2,1-2H3 |
| InChIKey | RLYDHNXBQFAFMI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|