C26H34O2 — CID 90371823
5,9,9,17,21,21-hexamethyl-10,22-dioxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2(11),4,12,16-pentaene (PubChem CID 90371823) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 5,9,9,17,21,21-hexamethyl-10,22-dioxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2(11),4,12,16-pentaene.
| Compound Name | 5,9,9,17,21,21-hexamethyl-10,22-dioxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2(11),4,12,16-pentaene |
|---|---|
| PubChem CID | 90371823 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 5,9,9,17,21,21-hexamethyl-10,22-dioxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2(11),4,12,16-pentaene |
| SMILES | CC1=CC2c3ccc4c(c3OC(C)(C)C2CC1)C1C=C(C)CCC1C(C)(C)O4 |
| InChI | InChI=1S/C26H34O2/c1-15-7-10-20-18(13-15)17-9-12-22-23(24(17)28-26(20,5)6)19-14-16(2)8-11-21(19)25(3,4)27-22/h9,12-14,18-21H,7-8,10-11H2,1-6H3 |
| InChIKey | LGPCERSHSHZYMG-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|