C23H18Cl2FNO2 — CID 90372005
(2S,5R,6S)-5,6-bis(4-chlorophenyl)-2-[(4-fluorophenyl)methyl]morpholin-3-one (PubChem CID 90372005) has the molecular formula C23H18Cl2FNO2 and a molecular weight of 430.31 g/mol. Its IUPAC name is (2S,5R,6S)-5,6-bis(4-chlorophenyl)-2-[(4-fluorophenyl)methyl]morpholin-3-one.
| Compound Name | (2S,5R,6S)-5,6-bis(4-chlorophenyl)-2-[(4-fluorophenyl)methyl]morpholin-3-one |
|---|---|
| PubChem CID | 90372005 |
| Molecular Formula | C23H18Cl2FNO2 |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | (2S,5R,6S)-5,6-bis(4-chlorophenyl)-2-[(4-fluorophenyl)methyl]morpholin-3-one |
| SMILES | O=C1N[C@H](c2ccc(Cl)cc2)[C@H](c2ccc(Cl)cc2)O[C@H]1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H18Cl2FNO2/c24-17-7-3-15(4-8-17)21-22(16-5-9-18(25)10-6-16)29-20(23(28)27-21)13-14-1-11-19(26)12-2-14/h1-12,20-22H,13H2,(H,27,28)/t20-,21+,22-/m0/s1 |
| InChIKey | NNHHVXDUFOZJBY-BDTNDASRSA-N |
| XLogP | 5.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |