C26H20F4N2O3 — CID 90372598
3-[2-[3-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]-2-pyridinyl]-3,4-dihydro-2H-chromen-6-yl]hex-4-ynoic acid (PubChem CID 90372598) has the molecular formula C26H20F4N2O3 and a molecular weight of 484.45 g/mol. Its IUPAC name is 3-[2-[3-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]-2-pyridinyl]-3,4-dihydro-2H-chromen-6-yl]hex-4-ynoic acid.
| Compound Name | 3-[2-[3-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]-2-pyridinyl]-3,4-dihydro-2H-chromen-6-yl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 90372598 |
| Molecular Formula | C26H20F4N2O3 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 3-[2-[3-fluoro-6-[2-(trifluoromethyl)-3-pyridinyl]-2-pyridinyl]-3,4-dihydro-2H-chromen-6-yl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc2c(c1)CCC(c1nc(-c3cccnc3C(F)(F)F)ccc1F)O2 |
| InChI | InChI=1S/C26H20F4N2O3/c1-2-4-15(14-23(33)34)16-6-10-21-17(13-16)7-11-22(35-21)24-19(27)8-9-20(32-24)18-5-3-12-31-25(18)26(28,29)30/h3,5-6,8-10,12-13,15,22H,7,11,14H2,1H3,(H,33,34) |
| InChIKey | RQPGTIRICHBBJM-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|