C33H36O4 — CID 90372602
(3S)-3-[2-[4-butoxy-3-(2,6-dimethylphenyl)phenyl]-3,4-dihydro-2H-chromen-6-yl]hex-4-ynoic acid (PubChem CID 90372602) has the molecular formula C33H36O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is (3S)-3-[2-[4-butoxy-3-(2,6-dimethylphenyl)phenyl]-3,4-dihydro-2H-chromen-6-yl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[2-[4-butoxy-3-(2,6-dimethylphenyl)phenyl]-3,4-dihydro-2H-chromen-6-yl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 90372602 |
| Molecular Formula | C33H36O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (3S)-3-[2-[4-butoxy-3-(2,6-dimethylphenyl)phenyl]-3,4-dihydro-2H-chromen-6-yl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc2c(c1)CCC(c1ccc(OCCCC)c(-c3c(C)cccc3C)c1)O2 |
| InChI | InChI=1S/C33H36O4/c1-5-7-18-36-31-17-14-27(20-28(31)33-22(3)10-8-11-23(33)4)30-16-13-26-19-25(12-15-29(26)37-30)24(9-6-2)21-32(34)35/h8,10-12,14-15,17,19-20,24,30H,5,7,13,16,18,21H2,1-4H3,(H,34,35)/t24-,30?/m0/s1 |
| InChIKey | AKDMOILZVCPDCO-YJJLJQPASA-N |
| XLogP | 7.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|