About [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate
[1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate (PubChem CID 90373189) has the molecular formula C18H22N2O9
and a molecular weight of 410.38 g/mol. Its IUPAC name is [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate.
Molecular Properties
| Compound Name | [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate |
| PubChem CID | 90373189 |
| Molecular Formula | C18H22N2O9 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate |
| SMILES | CC(C)C(OC(=O)CCCCN1C(=O)C=CC1=O)OC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C18H22N2O9/c1-11(2)17(28-18(26)29-20-14(23)8-9-15(20)24)27-16(25)5-3-4-10-19-12(21)6-7-13(19)22/h6-7,11,17H,3-5,8-10H2,1-2H3 |
| InChIKey | OVSOUFLZOPTFCN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate?
The IUPAC name of [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate (CID 90373189) is [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate.
What is the SMILES notation for [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate?
The canonical SMILES for [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate is CC(C)C(OC(=O)CCCCN1C(=O)C=CC1=O)OC(=O)ON1C(=O)CCC1=O.
What is the InChIKey of [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate?
The InChIKey is OVSOUFLZOPTFCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O9/c1-11(2)17(28-18(26)29-20-14(23)8-9-15(20)24)27-16(25)5-3-4-10-19-12(21)6-7-13(19)22/h6-7,11,17H,3-5,8-10H2,1-2H3.
What are the key properties of [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate?
[1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate has a molecular weight of 410.38 g/mol, XLogP of 0.82, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-2-methylpropyl] 5-(2,5-dioxopyrrol-1-yl)pentanoate is sourced from PubChem (CID 90373189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).