About 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate
1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate (PubChem CID 90373260) has the molecular formula C10H17F3N2O3S
and a molecular weight of 302.32 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate |
| PubChem CID | 90373260 |
| Molecular Formula | C10H17F3N2O3S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate |
| SMILES | CCCCn1cc[n+](C)c1.O=S(=O)([O-])C(F)(F)CF |
| InChI | InChI=1S/C8H15N2.C2H3F3O3S/c1-3-4-5-10-7-6-9(2)8-10;3-1-2(4,5)9(6,7)8/h6-8H,3-5H2,1-2H3;1H2,(H,6,7,8)/q+1;/p-1 |
| InChIKey | CZYIACQMKCLWFZ-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate (CID 90373260) is 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate is CCCCn1cc[n+](C)c1.O=S(=O)([O-])C(F)(F)CF.
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate?
The InChIKey is CZYIACQMKCLWFZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H15N2.C2H3F3O3S/c1-3-4-5-10-7-6-9(2)8-10;3-1-2(4,5)9(6,7)8/h6-8H,3-5H2,1-2H3;1H2,(H,6,7,8)/q+1;/p-1.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate?
1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate has a molecular weight of 302.32 g/mol, XLogP of 1.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoroethanesulfonate is sourced from PubChem (CID 90373260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).