C26H22N2O9 — CID 90373390
[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-phenylmethyl] 4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoate (PubChem CID 90373390) has the molecular formula C26H22N2O9 and a molecular weight of 506.47 g/mol. Its IUPAC name is [(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-phenylmethyl] 4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoate.
| Compound Name | [(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-phenylmethyl] 4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoate |
|---|---|
| PubChem CID | 90373390 |
| Molecular Formula | C26H22N2O9 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | [(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-phenylmethyl] 4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoate |
| SMILES | O=C(CCCc1ccc(N2C(=O)C=CC2=O)cc1)OC(OC(=O)ON1C(=O)CCC1=O)c1ccccc1 |
| InChI | InChI=1S/C26H22N2O9/c29-20-13-14-21(30)27(20)19-11-9-17(10-12-19)5-4-8-24(33)35-25(18-6-2-1-3-7-18)36-26(34)37-28-22(31)15-16-23(28)32/h1-3,6-7,9-14,25H,4-5,8,15-16H2 |
| InChIKey | LOTATDFIKGCNBR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|