C25H35N3O10 — CID 90373490
1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxybutyl 6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoate (PubChem CID 90373490) has the molecular formula C25H35N3O10 and a molecular weight of 537.57 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxybutyl 6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoate.
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxybutyl 6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 90373490 |
| Molecular Formula | C25H35N3O10 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxybutyl 6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoate |
| SMILES | CCCC(OC(=O)CCCCCNC(=O)CCCCCN1C(=O)C=CC1=O)OC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C25H35N3O10/c1-2-9-24(37-25(35)38-28-21(32)14-15-22(28)33)36-23(34)11-6-3-7-16-26-18(29)10-5-4-8-17-27-19(30)12-13-20(27)31/h12-13,24H,2-11,14-17H2,1H3,(H,26,29) |
| InChIKey | OXRSDTXZFIJRGU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|