C15H21Cl2N3O2Si — CID 90374051
tert-butyl-[2-[5-(5,6-dichloro-3-pyridinyl)-1,3,4-oxadiazol-2-yl]ethoxy]-dimethylsilane (PubChem CID 90374051) has the molecular formula C15H21Cl2N3O2Si and a molecular weight of 374.34 g/mol. Its IUPAC name is tert-butyl-[2-[5-(5,6-dichloro-3-pyridinyl)-1,3,4-oxadiazol-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[5-(5,6-dichloro-3-pyridinyl)-1,3,4-oxadiazol-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 90374051 |
| Molecular Formula | C15H21Cl2N3O2Si |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | tert-butyl-[2-[5-(5,6-dichloro-3-pyridinyl)-1,3,4-oxadiazol-2-yl]ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1nnc(-c2cnc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C15H21Cl2N3O2Si/c1-15(2,3)23(4,5)21-7-6-12-19-20-14(22-12)10-8-11(16)13(17)18-9-10/h8-9H,6-7H2,1-5H3 |
| InChIKey | UPDWIJHMEYRFAJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|