C13H22F2N2O2 — CID 90374673
N-[(1S,5R,6R)-6-amino-5-pentan-3-yloxycyclohex-3-en-1-yl]-2,2-difluoroacetamide (PubChem CID 90374673) has the molecular formula C13H22F2N2O2 and a molecular weight of 276.33 g/mol. Its IUPAC name is N-[(1S,5R,6R)-6-amino-5-pentan-3-yloxycyclohex-3-en-1-yl]-2,2-difluoroacetamide.
| Compound Name | N-[(1S,5R,6R)-6-amino-5-pentan-3-yloxycyclohex-3-en-1-yl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 90374673 |
| Molecular Formula | C13H22F2N2O2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-[(1S,5R,6R)-6-amino-5-pentan-3-yloxycyclohex-3-en-1-yl]-2,2-difluoroacetamide |
| SMILES | CCC(CC)O[C@@H]1C=CC[C@H](NC(=O)C(F)F)[C@H]1N |
| InChI | InChI=1S/C13H22F2N2O2/c1-3-8(4-2)19-10-7-5-6-9(11(10)16)17-13(18)12(14)15/h5,7-12H,3-4,6,16H2,1-2H3,(H,17,18)/t9-,10+,11+/m0/s1 |
| InChIKey | NNIOXNQSXSOLQO-HBNTYKKESA-N |
| XLogP | 1.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|