About [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride
[2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride (PubChem CID 90374796) has the molecular formula C7H14ClF3N2O2
and a molecular weight of 250.65 g/mol. Its IUPAC name is [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride.
Molecular Properties
| Compound Name | [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride |
| PubChem CID | 90374796 |
| Molecular Formula | C7H14ClF3N2O2 |
| Molecular Weight | 250.65 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CC(O)NC(=O)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C7H13F3N2O2.ClH/c1-12(2,3)4-5(13)11-6(14)7(8,9)10;/h5,13H,4H2,1-3H3;1H |
| InChIKey | CKKFGIOQVWQKMB-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.65 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride?
The IUPAC name of [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride (CID 90374796) is [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride.
What is the SMILES notation for [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride?
The canonical SMILES for [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride is C[N+](C)(C)CC(O)NC(=O)C(F)(F)F.[Cl-].
What is the InChIKey of [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride?
The InChIKey is CKKFGIOQVWQKMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N2O2.ClH/c1-12(2,3)4-5(13)11-6(14)7(8,9)10;/h5,13H,4H2,1-3H3;1H.
What are the key properties of [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride?
[2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride has a molecular weight of 250.65 g/mol, XLogP of -3.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-trimethylazanium chloride is sourced from PubChem (CID 90374796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).