About 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one
2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 90374937) has the molecular formula C7H4F3N3O
and a molecular weight of 203.12 g/mol. Its IUPAC name is 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| PubChem CID | 90374937 |
| Molecular Formula | C7H4F3N3O |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | O=C1Cc2cnc(C(F)(F)F)nc2N1 |
| InChI | InChI=1S/C7H4F3N3O/c8-7(9,10)6-11-2-3-1-4(14)12-5(3)13-6/h2H,1H2,(H,11,12,13,14) |
| InChIKey | LICNULFEHVVYPC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The IUPAC name of 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (CID 90374937) is 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
What is the SMILES notation for 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The canonical SMILES for 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one is O=C1Cc2cnc(C(F)(F)F)nc2N1.
What is the InChIKey of 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The InChIKey is LICNULFEHVVYPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3N3O/c8-7(9,10)6-11-2-3-1-4(14)12-5(3)13-6/h2H,1H2,(H,11,12,13,14).
What are the key properties of 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one has a molecular weight of 203.12 g/mol, XLogP of 0.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one is sourced from PubChem (CID 90374937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).