C10H12N2O — CID 90375224
4-[(cyclopropylamino)methyl]pyridine-2-carbaldehyde (PubChem CID 90375224) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-[(cyclopropylamino)methyl]pyridine-2-carbaldehyde.
| Compound Name | 4-[(cyclopropylamino)methyl]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 90375224 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-[(cyclopropylamino)methyl]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc(CNC2CC2)ccn1 |
| InChI | InChI=1S/C10H12N2O/c13-7-10-5-8(3-4-11-10)6-12-9-1-2-9/h3-5,7,9,12H,1-2,6H2 |
| InChIKey | MAJWEBKCHJIJKI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|