C28H48O3 — CID 90375308
(8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6-methoxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 90375308) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6-methoxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6-methoxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 90375308 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-17-[(2R)-5-hydroxy-6-methoxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | COC(C)(C)C(O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H48O3/c1-18(7-12-25(30)26(2,3)31-6)22-10-11-23-21-9-8-19-17-20(29)13-15-27(19,4)24(21)14-16-28(22,23)5/h8,18,20-25,29-30H,7,9-17H2,1-6H3/t18-,20?,21+,22-,23+,24+,25?,27+,28-/m1/s1 |
| InChIKey | QWLUOXHULBVDKE-VMVJMPLZSA-N |
| XLogP | 6.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|