C21H29NO6 — CID 90375377
[3-[(6aR,10aR)-6a-hydroxy-9-(hydroxymethyl)-6,6-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-3-yl]-3-methylbutyl] nitrate (PubChem CID 90375377) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is [3-[(6aR,10aR)-6a-hydroxy-9-(hydroxymethyl)-6,6-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-3-yl]-3-methylbutyl] nitrate.
| Compound Name | [3-[(6aR,10aR)-6a-hydroxy-9-(hydroxymethyl)-6,6-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-3-yl]-3-methylbutyl] nitrate |
|---|---|
| PubChem CID | 90375377 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [3-[(6aR,10aR)-6a-hydroxy-9-(hydroxymethyl)-6,6-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-3-yl]-3-methylbutyl] nitrate |
| SMILES | CC(C)(CCO[N+](=O)[O-])c1ccc2c(c1)OC(C)(C)[C@@]1(O)CC=C(CO)C[C@H]21 |
| InChI | InChI=1S/C21H29NO6/c1-19(2,9-10-27-22(25)26)15-5-6-16-17-11-14(13-23)7-8-21(17,24)20(3,4)28-18(16)12-15/h5-7,12,17,23-24H,8-11,13H2,1-4H3/t17-,21-/m1/s1 |
| InChIKey | GPKAPIFILRNQQF-DYESRHJHSA-N |
| XLogP | 3.26 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|