C11H12S — CID 90375458
5,6-didehydro-7,8,9,10-tetrahydro-2H-cycloocta[b]thiopyran (PubChem CID 90375458) has the molecular formula C11H12S and a molecular weight of 176.28 g/mol. Its IUPAC name is 5,6-didehydro-7,8,9,10-tetrahydro-2H-cycloocta[b]thiopyran.
| Compound Name | 5,6-didehydro-7,8,9,10-tetrahydro-2H-cycloocta[b]thiopyran |
|---|---|
| PubChem CID | 90375458 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 5,6-didehydro-7,8,9,10-tetrahydro-2H-cycloocta[b]thiopyran |
| SMILES | C1#CC2=C(CCCC1)SCC=C2 |
| InChI | InChI=1S/C11H12S/c1-2-4-8-11-10(6-3-1)7-5-9-12-11/h5,7H,1-2,4,8-9H2 |
| InChIKey | UQLJNPDOIOLWSQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|