About methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate
methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate (PubChem CID 90375740) has the molecular formula C13H14N2O3
and a molecular weight of 246.27 g/mol. Its IUPAC name is methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate.
Molecular Properties
| Compound Name | methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate |
| PubChem CID | 90375740 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate |
| SMILES | COC(=O)c1cc(N)cc(-c2c(C)noc2C)c1 |
| InChI | InChI=1S/C13H14N2O3/c1-7-12(8(2)18-15-7)9-4-10(13(16)17-3)6-11(14)5-9/h4-6H,14H2,1-3H3 |
| InChIKey | CEGDWRFGPGOTIM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate?
The IUPAC name of methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate (CID 90375740) is methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate.
What is the SMILES notation for methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate?
The canonical SMILES for methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate is COC(=O)c1cc(N)cc(-c2c(C)noc2C)c1.
What is the InChIKey of methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate?
The InChIKey is CEGDWRFGPGOTIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c1-7-12(8(2)18-15-7)9-4-10(13(16)17-3)6-11(14)5-9/h4-6H,14H2,1-3H3.
What are the key properties of methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate?
methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate has a molecular weight of 246.27 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate is sourced from PubChem (CID 90375740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).