C27H31N3O4 — CID 90375863
2-(3,5-dimethyl-1,2-oxazol-4-yl)-7-(2-hydroxypropan-2-yl)-9-(oxan-4-ylmethyl)carbazole-4-carboxamide (PubChem CID 90375863) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-7-(2-hydroxypropan-2-yl)-9-(oxan-4-ylmethyl)carbazole-4-carboxamide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-7-(2-hydroxypropan-2-yl)-9-(oxan-4-ylmethyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 90375863 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-7-(2-hydroxypropan-2-yl)-9-(oxan-4-ylmethyl)carbazole-4-carboxamide |
| SMILES | Cc1noc(C)c1-c1cc(C(N)=O)c2c3ccc(C(C)(C)O)cc3n(CC3CCOCC3)c2c1 |
| InChI | InChI=1S/C27H31N3O4/c1-15-24(16(2)34-29-15)18-11-21(26(28)31)25-20-6-5-19(27(3,4)32)13-22(20)30(23(25)12-18)14-17-7-9-33-10-8-17/h5-6,11-13,17,32H,7-10,14H2,1-4H3,(H2,28,31) |
| InChIKey | YPTAOBVCBZIKKT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|