C20H21F2NO7 — CID 90375864
4-nitrooxybutyl 2-[4-(3,5-dimethylphenyl)-3,5-dihydroxyphenyl]-2,2-difluoroacetate (PubChem CID 90375864) has the molecular formula C20H21F2NO7 and a molecular weight of 425.38 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-[4-(3,5-dimethylphenyl)-3,5-dihydroxyphenyl]-2,2-difluoroacetate.
| Compound Name | 4-nitrooxybutyl 2-[4-(3,5-dimethylphenyl)-3,5-dihydroxyphenyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 90375864 |
| Molecular Formula | C20H21F2NO7 |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 4-nitrooxybutyl 2-[4-(3,5-dimethylphenyl)-3,5-dihydroxyphenyl]-2,2-difluoroacetate |
| SMILES | Cc1cc(C)cc(-c2c(O)cc(C(F)(F)C(=O)OCCCCO[N+](=O)[O-])cc2O)c1 |
| InChI | InChI=1S/C20H21F2NO7/c1-12-7-13(2)9-14(8-12)18-16(24)10-15(11-17(18)25)20(21,22)19(26)29-5-3-4-6-30-23(27)28/h7-11,24-25H,3-6H2,1-2H3 |
| InChIKey | YYPCXVPTPIJQMR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|