About 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid
3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid (PubChem CID 90375881) has the molecular formula C19H18N2O5S
and a molecular weight of 386.43 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid |
| PubChem CID | 90375881 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid |
| SMILES | Cc1noc(C)c1-c1cc(Nc2ccc(S(C)(=O)=O)cc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C19H18N2O5S/c1-11-18(12(2)26-21-11)13-8-14(19(22)23)10-16(9-13)20-15-4-6-17(7-5-15)27(3,24)25/h4-10,20H,1-3H3,(H,22,23) |
| InChIKey | FJXDLLIRIIRSEG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid?
The IUPAC name of 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid (CID 90375881) is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid.
What is the SMILES notation for 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid?
The canonical SMILES for 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid is Cc1noc(C)c1-c1cc(Nc2ccc(S(C)(=O)=O)cc2)cc(C(=O)O)c1.
What is the InChIKey of 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid?
The InChIKey is FJXDLLIRIIRSEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O5S/c1-11-18(12(2)26-21-11)13-8-14(19(22)23)10-16(9-13)20-15-4-6-17(7-5-15)27(3,24)25/h4-10,20H,1-3H3,(H,22,23).
What are the key properties of 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid?
3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid has a molecular weight of 386.43 g/mol, XLogP of 3.80, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methylsulfonylanilino)benzoic acid is sourced from PubChem (CID 90375881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).