C18H23NO5 — CID 90375917
2-[(6aR,10aR)-6a-hydroxy-6,6,9-trimethyl-10,10a-dihydro-7H-benzo[c]chromen-3-yl]ethyl nitrate (PubChem CID 90375917) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-[(6aR,10aR)-6a-hydroxy-6,6,9-trimethyl-10,10a-dihydro-7H-benzo[c]chromen-3-yl]ethyl nitrate.
| Compound Name | 2-[(6aR,10aR)-6a-hydroxy-6,6,9-trimethyl-10,10a-dihydro-7H-benzo[c]chromen-3-yl]ethyl nitrate |
|---|---|
| PubChem CID | 90375917 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[(6aR,10aR)-6a-hydroxy-6,6,9-trimethyl-10,10a-dihydro-7H-benzo[c]chromen-3-yl]ethyl nitrate |
| SMILES | CC1=CC[C@@]2(O)[C@H](C1)c1ccc(CCO[N+](=O)[O-])cc1OC2(C)C |
| InChI | InChI=1S/C18H23NO5/c1-12-6-8-18(20)15(10-12)14-5-4-13(7-9-23-19(21)22)11-16(14)24-17(18,2)3/h4-6,11,15,20H,7-10H2,1-3H3/t15-,18-/m1/s1 |
| InChIKey | HXHUOKWYSVWBJA-CRAIPNDOSA-N |
| XLogP | 3.16 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|