C36H57NO13 — CID 90375945
[(6aR,10aR)-6,6,9-trimethyl-3-(5-nitrooxypentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 90375945) has the molecular formula C36H57NO13 and a molecular weight of 711.85 g/mol. Its IUPAC name is [(6aR,10aR)-6,6,9-trimethyl-3-(5-nitrooxypentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | [(6aR,10aR)-6,6,9-trimethyl-3-(5-nitrooxypentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 90375945 |
| Molecular Formula | C36H57NO13 |
| Molecular Weight | 711.85 g/mol |
| Exact Mass | 711.38 |
| IUPAC Name | [(6aR,10aR)-6,6,9-trimethyl-3-(5-nitrooxypentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | COCCOCCOCCOCCOCCOCCOCC(=O)Oc1cc(CCCCCO[N+](=O)[O-])cc2c1[C@@H]1C=C(C)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C36H57NO13/c1-28-9-10-31-30(24-28)35-32(25-29(26-33(35)50-36(31,2)3)8-6-5-7-11-48-37(39)40)49-34(38)27-47-23-22-46-21-20-45-19-18-44-17-16-43-15-14-42-13-12-41-4/h24-26,30-31H,5-23,27H2,1-4H3/t30-,31-/m1/s1 |
| InChIKey | JDUCFTZKBVGMKS-FIRIVFDPSA-N |
| XLogP | 4.87 |
| TPSA | 152.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|